Products 210530-71-5
CAS 210530-71-5 appears in our catalog under these names: 3,4-Difluorophenylacetic acid methyl ester, 96%, 3,4–Difluorophenylacetic acid methyl ester, Methyl 2-(3,4-difluorophenyl)acetate 98%, Methyl 2-(3,4-difluorophenyl)acetate, 97%, 97%, 3,4-Difluorophenylacetic acid methyl ester, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 100mg, 250mg.
Methyl 2-(3,4-difluorophenyl)acetate (CAS 210530-71-5) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: methyl 2-(3,4-difluorophenyl)acetate. InChIKey: WXOJCEHMQHERFQ-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | methyl 2-(3,4-difluorophenyl)acetate |
| InChIKey | WXOJCEHMQHERFQ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)