CAS 108928-00-3 appears in our catalog under these names: Ethyl 2,4-difluorobenzoate, 97%, Ethyl 2,4–Difluorobenzoate, 2,4-Difluorobenzoic acid ethyl ester, Ethyl 2,4-Difluorobenzoate, >98.0%(GC), Ethyl 2,4-Difluorobenzoate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 100g, 25g, 500g, 5g, 0,25kg, 10g, 1g, 15g.
Ethyl 2,4-difluorobenzoate (CAS 108928-00-3) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: ethyl 2,4-difluorobenzoate. InChIKey: OPQFYGPAOVCNEQ-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | ethyl 2,4-difluorobenzoate |
| InChIKey | OPQFYGPAOVCNEQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)