cas: 5333-27-7 — see every product listed under this CAS number, including other names
1-(4-Methyl-3-nitrophenyl)ethanone, 95%, 95% (CAS 5333-27-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LQN-1g |
| cas | 5333-27-7 |
| size | 1g |
| availability | 800g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 179.60 Pln | |
| Chemat | 100g | 501.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(4-methyl-3-nitrophenyl)ethanone (CAS 5333-27-7) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 1-(4-methyl-3-nitrophenyl)ethanone. InChIKey: YRBBMDOBWRUMEZ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 1-(4-methyl-3-nitrophenyl)ethanone |
| InChIKey | YRBBMDOBWRUMEZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)