Products 23362-56-3
CAS 23362-56-3 appears in our catalog under these names: 2-(2-Carbamoylphenyl)acetic acid, 95%, 2-(2-carbamoylphenyl)acetic acid, 2-(2-Carbamoylphenyl)acetic Acid, >95% (HPLC), 2-(2-Carbamoylphenyl)acetic acid, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 10g, 1g, on request, 100mg, 10mg, 50mg.
2-(2-carbamoylphenyl)acetic acid (CAS 23362-56-3) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 2-(2-carbamoylphenyl)acetic acid. InChIKey: PFWJWJJACBUZDS-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 2-(2-carbamoylphenyl)acetic acid |
| InChIKey | PFWJWJJACBUZDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)C(=O)N |
Computed by PubChem (NCBI)