CAS 33070-04-1 appears in our catalog under these names: 2,3-Dihydro-benzo[1,4]dioxine-2-carboxylic acid amide, 95%, 2,3-Dihydrobenzo(b)(1,4)dioxine-2-carboxamide, 97%, 2,3-Dihydrobenzo[b][1,4]dioxine-2-carboxamide, 97%, 97%, 2,3-Dihydrobenzo[b][1,4]dioxine-2-carboxamide, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g.
2,3-dihydro-1,4-benzodioxine-3-carboxamide (CAS 33070-04-1) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-3-carboxamide. InChIKey: LIQWNOWUUZXEPC-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| InChIKey | LIQWNOWUUZXEPC-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2O1)C(=O)N |
Computed by PubChem (NCBI)