CAS 115122-63-9 appears in our catalog under these names: 2-Oxo-2,5,6,7-tetrahydro-1h-cyclopenta[b]pyridine-3-carboxylic acid, 95%, 2,5,6,7-tetrahydro-2-oxo-1H-Cyclopenta[b]pyridine-3-carboxylic acid, 95%, 95%, 2-Hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 5g, 1g, 250mg, 10g.
2-oxo-1,5,6,7-tetrahydrocyclopenta[b]pyridine-3-carboxylic acid (CAS 115122-63-9) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 2-oxo-1,5,6,7-tetrahydrocyclopenta[b]pyridine-3-carboxylic acid. InChIKey: GOBCNYSBQFAPOI-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 2-oxo-1,5,6,7-tetrahydrocyclopenta[b]pyridine-3-carboxylic acid |
| InChIKey | GOBCNYSBQFAPOI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)NC(=O)C(=C2)C(=O)O |
Computed by PubChem (NCBI)