CAS 53589-27-8 appears in our catalog under these names: 5-Acetyl-2-aminobenzoic acid, 95%, 2–Amino–5–Acetylbenzoic Acid, 5-Acetyl-2-Aminobenzoic Acid, 97%+,RG, 97%+,RG, 2-AMINO-5-ACETYLBENZOIC ACID. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
5-acetyl-2-aminobenzoic acid (CAS 53589-27-8) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 5-acetyl-2-aminobenzoic acid. InChIKey: UHAJXWNQVHUJAH-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 5-acetyl-2-aminobenzoic acid |
| InChIKey | UHAJXWNQVHUJAH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)N)C(=O)O |
Computed by PubChem (NCBI)