CAS 153559-93-4 appears in our catalog under these names: Methyl 6-acetylnicotinate, 95%, Methyl 6–Acetylnicotinate, 3-Pyridinecarboxylic acid, 6-acetyl-, methyl ester, Methyl 6-acetylnicotinate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 0,5g.
Methyl 6-acetylpyridine-3-carboxylate (CAS 153559-93-4) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: methyl 6-acetylpyridine-3-carboxylate. InChIKey: GORGQDZBRJIMDB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | methyl 6-acetylpyridine-3-carboxylate |
| InChIKey | GORGQDZBRJIMDB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)