CAS 6529-94-8 appears in our catalog under these names: 7-Methoxy-2h-benzo[b][1,4]oxazin-3(4h)-one, 95%, 7-Methoxy-2H-benzo(b)(1,4)oxazin-3(4H)-one, 7-Methoxy-2H-benzo[b][1,4]oxazin-3(4H)-one 97%, 7-Methoxy-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%, 97%, 7-Methoxy-2H-benzo[b][1,4]oxazin-3(4H)-one, 96%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g, 25g.
7-methoxy-4H-1,4-benzoxazin-3-one (CAS 6529-94-8) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 7-methoxy-4H-1,4-benzoxazin-3-one. InChIKey: UGJVRGLKGBFDOD-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 7-methoxy-4H-1,4-benzoxazin-3-one |
| InChIKey | UGJVRGLKGBFDOD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=O)CO2 |
Computed by PubChem (NCBI)