cas: 4023-79-4 — see every product listed under this CAS number, including other names
1-(4-Methylphenyl)butane-1,3-dione, 97% (CAS 4023-79-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F369881-1G |
| cas | 4023-79-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1539.06 Pln | |
| Fluorochem | 5g | 4767.09 Pln | |
| Fluorochem | 500mg | 1039.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-methylphenyl)butane-1,3-dione (CAS 4023-79-4) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 1-(4-methylphenyl)butane-1,3-dione. InChIKey: QJRMUROMTUDYAH-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(4-methylphenyl)butane-1,3-dione |
| InChIKey | QJRMUROMTUDYAH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC(=O)C |
Computed by PubChem (NCBI)