CAS 4023-79-4 appears in our catalog under these names: 1-(4-Methylphenyl)butane-1,3-dione, 1-(4-Methylphenyl)butane-1,3-dione, 97%, 1-P-Tolylbutane-1,3-dione, 95%, 1-(p-Tolyl)butane-1,3-dione, >98.0%(GC), 1-(p-Tolyl)butane-1,3-dione 95%. Offered by: Biosynth, Fluorochem, Combi-blocks, TCI, Ambeed. Available pack sizes: 2g, 5g, 1g, 500mg, 250mg, 100mg.
1-(4-methylphenyl)butane-1,3-dione (CAS 4023-79-4) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 1-(4-methylphenyl)butane-1,3-dione. InChIKey: QJRMUROMTUDYAH-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(4-methylphenyl)butane-1,3-dione |
| InChIKey | QJRMUROMTUDYAH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC(=O)C |
Computed by PubChem (NCBI)