cas: 119192-09-5 — see every product listed under this CAS number, including other names
1-(4-Nitrobenzyl)-1,2,4-triazole, >98.0%(GC) (CAS 119192-09-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N1007-5G |
| cas | 119192-09-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 393.71 Pln | |
| TCI | 25g | 1465.67 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-[(4-nitrophenyl)methyl]-1,2,4-triazole (CAS 119192-09-5) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 1-[(4-nitrophenyl)methyl]-1,2,4-triazole. InChIKey: NVRYCUYVBBCXHT-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 1-[(4-nitrophenyl)methyl]-1,2,4-triazole |
| InChIKey | NVRYCUYVBBCXHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)