CAS 168968-51-2 appears in our catalog under these names: 4-Methyl-3-(3-nitrophenyl)-4h-1,2,4-triazole, 95%, 4-Methyl-3-(3-nitrophenyl)-4H-1,2,4-triazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-methyl-3-(3-nitrophenyl)-1,2,4-triazole (CAS 168968-51-2) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 4-methyl-3-(3-nitrophenyl)-1,2,4-triazole. InChIKey: QXWWRCQULISQCV-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 4-methyl-3-(3-nitrophenyl)-1,2,4-triazole |
| InChIKey | QXWWRCQULISQCV-UHFFFAOYSA-N |
| SMILES | CN1C=NN=C1C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)