CAS 119192-09-5 appears in our catalog under these names: 1-[(4-Nitrophenyl)methyl]-1h-1,2,4-triazole, 95%, 1-(4-Nitrobenzyl)-1H-1,2,4-triazole, >95% (HPLC), 1–(4–Nitrobenzyl)–1,2,4–triazole, 1-(4-Nitrobenzyl)-1,2,4-triazole, >98.0%(GC), 1-((4-Nitrophenyl)methyl)-1H-1,2,4-triazole. Offered by: Combi-blocks, TRC, GLPBio, TCI, Biosynth. Available pack sizes: 25g, 5g, 1g, 2,5g, 500mg, 10g.
1-[(4-nitrophenyl)methyl]-1,2,4-triazole (CAS 119192-09-5) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 1-[(4-nitrophenyl)methyl]-1,2,4-triazole. InChIKey: NVRYCUYVBBCXHT-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 1-[(4-nitrophenyl)methyl]-1,2,4-triazole |
| InChIKey | NVRYCUYVBBCXHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)