CAS 99367-59-6 is the registry number for 5-Phenyl-1,3,4-oxadiazole-2-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-phenyl-1,3,4-oxadiazole-2-carbohydrazide (CAS 99367-59-6) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 5-phenyl-1,3,4-oxadiazole-2-carbohydrazide. InChIKey: SVYAUJBFTYCAKJ-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 5-phenyl-1,3,4-oxadiazole-2-carbohydrazide |
| InChIKey | SVYAUJBFTYCAKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)C(=O)NN |
Computed by PubChem (NCBI)