CAS 915920-19-3 appears in our catalog under these names: 2-Amino-4-(4h-1,2,4-triazol-4-yl)benzoic acid, 95%, 2-Amino-4-(4H-1,2,4-triazol-4-yl)benzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-amino-4-(1,2,4-triazol-4-yl)benzoic acid (CAS 915920-19-3) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 2-amino-4-(1,2,4-triazol-4-yl)benzoic acid. InChIKey: NEDSNKGNAVUYFJ-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 2-amino-4-(1,2,4-triazol-4-yl)benzoic acid |
| InChIKey | NEDSNKGNAVUYFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C=NN=C2)N)C(=O)O |
Computed by PubChem (NCBI)