CAS 72693-60-8 appears in our catalog under these names: 4-(Phenylamino)-1h-1,2,3-triazole-5-carboxylic acid, 95%, 4–(Phenylamino)–1H–1,2,3–triazole–5–carboxylic acid, 4-(Phenylamino)-1H-1,2,3-triazole-5-carboxylic acid 97%, 4-(Phenylamino)-1H-1,2,3-triazole-5-carboxylic acid, 97%, 97%, 4-(PHENYLAMINO)-1H-1,2,3-TRIAZOLE-5-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg.
5-anilino-2H-triazole-4-carboxylic acid (CAS 72693-60-8) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 5-anilino-2H-triazole-4-carboxylic acid. InChIKey: QLPAJQMELGXQCL-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 5-anilino-2H-triazole-4-carboxylic acid |
| InChIKey | QLPAJQMELGXQCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NNN=C2C(=O)O |
Computed by PubChem (NCBI)