CAS 1195606-79-1 appears in our catalog under these names: 2-(5-Amino-1h-1,2,4-triazol-3-yl)benzoic acid, 95%, 2-(5-Amino-1H-1,2,4-triazol-3-yl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(3-amino-1H-1,2,4-triazol-5-yl)benzoic acid (CAS 1195606-79-1) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 2-(3-amino-1H-1,2,4-triazol-5-yl)benzoic acid. InChIKey: GSWHDMVMXOOKEU-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 2-(3-amino-1H-1,2,4-triazol-5-yl)benzoic acid |
| InChIKey | GSWHDMVMXOOKEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NN2)N)C(=O)O |
Computed by PubChem (NCBI)