cas: 173974-88-4 — see every product listed under this CAS number, including other names
1-(4-bromophenyl)-2,2-difluoroethanone, 95%, 95% (CAS 173974-88-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112ZBH-100mg |
| cas | 173974-88-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 645.20 Pln | |
| Chemat | 250mg | 1053.20 Pln | |
| Chemat | 1g | 2541.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromophenyl)-2,2-difluoroethanone (CAS 173974-88-4) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2-difluoroethanone. InChIKey: AULWQWKDUPKRJT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2-difluoroethanone |
| InChIKey | AULWQWKDUPKRJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(F)F)Br |
Computed by PubChem (NCBI)