cas: 41877-24-1 — see every product listed under this CAS number, including other names
1-(5-Bromo-2-nitro-phenyl)ethanone, 95% (CAS 41877-24-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F046345-250MG |
| cas | 41877-24-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 529.00 Pln | |
| Fluorochem | 25g | 1002.79 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(5-bromo-2-nitrophenyl)ethanone (CAS 41877-24-1) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 1-(5-bromo-2-nitrophenyl)ethanone. InChIKey: AFDAUYYWZNNSFV-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 1-(5-bromo-2-nitrophenyl)ethanone |
| InChIKey | AFDAUYYWZNNSFV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)