cas: 41877-24-1 — see every product listed under this CAS number, including other names
1-(5-Bromo-2-nitrophenyl)ethanone, 95%, 95% (CAS 41877-24-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C1K0-100mg |
| cas | 41877-24-1 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 256.40 Pln | |
| Chemat | 10g | 448.40 Pln | |
| Chemat | 25g | 909.20 Pln | |
| Chemat | 50g | 1701.20 Pln | |
| Chemat | 100g | 2891.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(5-bromo-2-nitrophenyl)ethanone (CAS 41877-24-1) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 1-(5-bromo-2-nitrophenyl)ethanone. InChIKey: AFDAUYYWZNNSFV-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 1-(5-bromo-2-nitrophenyl)ethanone |
| InChIKey | AFDAUYYWZNNSFV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)