cas: 1363382-81-3 — see every product listed under this CAS number, including other names
1-(5-Bromo-3-nitropyridin-2-yl)ethanone 95% (CAS 1363382-81-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A394351-100mg |
| cas | 1363382-81-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 420.44 Pln | |
| Ambeed | 250mg | 654.06 Pln | |
| Ambeed | 1g | 1694.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A394351 |
1-(5-bromo-3-nitro-2-pyridinyl)ethanone (CAS 1363382-81-3) is a chemical compound with the molecular formula C7H5BrN2O3 and a molecular weight of 245.03 g/mol. IUPAC name: 1-(5-bromo-3-nitro-2-pyridinyl)ethanone. InChIKey: QPUXVERERDQWCV-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O3 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 1-(5-bromo-3-nitro-2-pyridinyl)ethanone |
| InChIKey | QPUXVERERDQWCV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=N1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)