CAS 41052-26-0 appears in our catalog under these names: 2-Bromo-5-nitrobenzamide, 98%, 2-BROMO-5-NITRO-BENZAMIDE. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g.
2-bromo-5-nitrobenzamide (CAS 41052-26-0) is a chemical compound with the molecular formula C7H5BrN2O3 and a molecular weight of 245.03 g/mol. IUPAC name: 2-bromo-5-nitrobenzamide. InChIKey: KQSFFJRDGVAPPI-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O3 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 2-bromo-5-nitrobenzamide |
| InChIKey | KQSFFJRDGVAPPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)N)Br |
Computed by PubChem (NCBI)