CAS 879-93-6 appears in our catalog under these names: 4-Bromo-3-nitrobenzamide, 98%, 4-Bromo-3-nitrobenzamide, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
4-bromo-3-nitrobenzamide (CAS 879-93-6) is a chemical compound with the molecular formula C7H5BrN2O3 and a molecular weight of 245.03 g/mol. IUPAC name: 4-bromo-3-nitrobenzamide. InChIKey: XEXLVJPVLGTROT-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O3 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 4-bromo-3-nitrobenzamide |
| InChIKey | XEXLVJPVLGTROT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)