Products 1261794-86-8
CAS 1261794-86-8 is the registry number for 3-Bromo-4-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-4-nitrobenzamide (CAS 1261794-86-8) is a chemical compound with the molecular formula C7H5BrN2O3 and a molecular weight of 245.03 g/mol. IUPAC name: 3-bromo-4-nitrobenzamide. InChIKey: WASHERDYVKIIBK-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O3 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 3-bromo-4-nitrobenzamide |
| InChIKey | WASHERDYVKIIBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)