CAS 1951439-64-7 is the registry number for 2-Amino-3-bromo-5-nitrobenzaldehyde, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-amino-3-bromo-5-nitrobenzaldehyde (CAS 1951439-64-7) is a chemical compound with the molecular formula C7H5BrN2O3 and a molecular weight of 245.03 g/mol. IUPAC name: 2-amino-3-bromo-5-nitrobenzaldehyde. InChIKey: WLZCOZHKZWETRD-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O3 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 2-amino-3-bromo-5-nitrobenzaldehyde |
| InChIKey | WLZCOZHKZWETRD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)