Products 89642-23-9
CAS 89642-23-9 is the registry number for 5-Bromo-2-nitrobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
5-bromo-2-nitrobenzamide (CAS 89642-23-9) is a chemical compound with the molecular formula C7H5BrN2O3 and a molecular weight of 245.03 g/mol. IUPAC name: 5-bromo-2-nitrobenzamide. InChIKey: SGFOXBODMLDOCU-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O3 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 5-bromo-2-nitrobenzamide |
| InChIKey | SGFOXBODMLDOCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)