CAS 54321-80-1 appears in our catalog under these names: 3-Bromo-5-nitrobenzamide, 98%, 3-Bromo-5-nitrobenzamide, 95+%, 3–Bromo–5–nitrobenzamide, 3-Bromo-5-nitrobenzamide, 3-Bromo-5-nitrobenzamide, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 100g, 25g, 5g, 250mg, 10g.
3-bromo-5-nitrobenzamide (CAS 54321-80-1) is a chemical compound with the molecular formula C7H5BrN2O3 and a molecular weight of 245.03 g/mol. IUPAC name: 3-bromo-5-nitrobenzamide. InChIKey: WNYWPPUDAKYNIZ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O3 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 3-bromo-5-nitrobenzamide |
| InChIKey | WNYWPPUDAKYNIZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])Br)C(=O)N |
Computed by PubChem (NCBI)