cas: 69976-70-1 — see every product listed under this CAS number, including other names
1-(5-Methyl-2-nitrophenyl)ethanone, 98%, 98% (CAS 69976-70-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140GY-100g |
| cas | 69976-70-1 |
| size | 100g |
| availability | 147g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 2406.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 10g | 352.40 Pln | |
| Chemat | 25g | 750.80 Pln | |
| Chemat | 50g | 1370.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(5-methyl-2-nitrophenyl)ethanone (CAS 69976-70-1) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 1-(5-methyl-2-nitrophenyl)ethanone. InChIKey: QTVGOWDJTGISJG-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 1-(5-methyl-2-nitrophenyl)ethanone |
| InChIKey | QTVGOWDJTGISJG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)C |
Computed by PubChem (NCBI)