cas: 28657-75-2 — see every product listed under this CAS number, including other names
1-(6-Aminobenzo[d][1,3]dioxol-5-yl)ethanone, 98%, 98% (CAS 28657-75-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113VZJ-250mg |
| cas | 28657-75-2 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 414.80 Pln | |
| Chemat | 25g | 1298.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(6-amino-1,3-benzodioxol-5-yl)ethanone (CAS 28657-75-2) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 1-(6-amino-1,3-benzodioxol-5-yl)ethanone. InChIKey: DWTHYSZSRJOMSC-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 1-(6-amino-1,3-benzodioxol-5-yl)ethanone |
| InChIKey | DWTHYSZSRJOMSC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1N)OCO2 |
Computed by PubChem (NCBI)