cas: 1523606-25-8 — see every product listed under this CAS number, including other names
1-(AZETIDIN-3-YL)AZETIDIN-3-OL OXALATE, 95%, 95% (CAS 1523606-25-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HY1F-100mg |
| cas | 1523606-25-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 630.80 Pln | |
| Chemat | 250mg | 966.80 Pln | |
| Chemat | 1g | 2416.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(azetidin-3-yl)azetidin-3-ol;oxalic acid (CAS 1523606-25-8) is a chemical compound with the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. IUPAC name: 1-(azetidin-3-yl)azetidin-3-ol;oxalic acid. InChIKey: YJJCKGAJFDIXPA-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O5 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 1-(azetidin-3-yl)azetidin-3-ol;oxalic acid |
| InChIKey | YJJCKGAJFDIXPA-UHFFFAOYSA-N |
| SMILES | C1C(CN1)N2CC(C2)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)