Products 1392113-56-2
CAS 1392113-56-2 is the registry number for 1-(2-Aminoethyl)-2-pyrrolidinone oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-(2-aminoethyl)pyrrolidin-2-one;oxalic acid (CAS 1392113-56-2) is a chemical compound with the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. IUPAC name: 1-(2-aminoethyl)pyrrolidin-2-one;oxalic acid. InChIKey: QYZKNKOTEWCTCP-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O5 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 1-(2-aminoethyl)pyrrolidin-2-one;oxalic acid |
| InChIKey | QYZKNKOTEWCTCP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)