Products 5438-83-5

CAS 5438-83-5 is the registry number for (Nitrosoimino)bisacetic acid diethyl ester. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[(2-ethoxy-2-oxoethyl)-nitrosoamino]acetate (CAS 5438-83-5) is a chemical compound with the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. IUPAC name: ethyl 2-[(2-ethoxy-2-oxoethyl)-nitrosoamino]acetate. InChIKey: LENSNDVFRZHYFV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14N2O5
Molecular weight218.21 g/mol
IUPAC nameethyl 2-[(2-ethoxy-2-oxoethyl)-nitrosoamino]acetate
InChIKeyLENSNDVFRZHYFV-UHFFFAOYSA-N
SMILESCCOC(=O)CN(CC(=O)OCC)N=O

Computed by PubChem (NCBI)