CAS 1630907-32-2 appears in our catalog under these names: 1-(3-Oxetanyl)-3-azetidinamine oxalate, 95%, 1-(Oxetan-3-yl)azetidin-3-amine oxalate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 10g.
Oxalic acid;1-(oxetan-3-yl)azetidin-3-amine (CAS 1630907-32-2) is a chemical compound with the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. IUPAC name: oxalic acid;1-(oxetan-3-yl)azetidin-3-amine. InChIKey: FZAKJZDLECEMIU-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O5 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | oxalic acid;1-(oxetan-3-yl)azetidin-3-amine |
| InChIKey | FZAKJZDLECEMIU-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2COC2)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)