Products 500880-58-0

CAS 500880-58-0 is the registry number for Diethyl Ureidomalonate. Offered by: TRC. Available pack sizes: 10g, 2g, 5g.

Structural formula: {0} (CAS {1})

Diethyl 2-(carbamoylamino)propanedioate (CAS 500880-58-0) is a chemical compound with the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. IUPAC name: diethyl 2-(carbamoylamino)propanedioate. InChIKey: HHIQUVWDEJKFDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14N2O5
Molecular weight218.21 g/mol
IUPAC namediethyl 2-(carbamoylamino)propanedioate
InChIKeyHHIQUVWDEJKFDJ-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(=O)OCC)NC(=O)N

Computed by PubChem (NCBI)