CAS 1609395-46-1 appears in our catalog under these names: 5-(Aminomethyl)-1-methyl-2-pyrrolidinone oxalate, 95%, 5-(Aminomethyl)-1-methylpyrrolidin-2-one oxalate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
5-(aminomethyl)-1-methylpyrrolidin-2-one;oxalic acid (CAS 1609395-46-1) is a chemical compound with the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. IUPAC name: 5-(aminomethyl)-1-methylpyrrolidin-2-one;oxalic acid. InChIKey: KMLZBKXROGJYQG-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O5 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 5-(aminomethyl)-1-methylpyrrolidin-2-one;oxalic acid |
| InChIKey | KMLZBKXROGJYQG-UHFFFAOYSA-N |
| SMILES | CN1C(CCC1=O)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)