CAS 5238-83-5 is the registry number for H-L-Lys(Oxalyl)-OH. Offered by: Iris Biotech. Available pack sizes: 10mg, 50mg.
(2S)-2-amino-6-(oxaloamino)hexanoic acid (CAS 5238-83-5) is a chemical compound with the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. IUPAC name: (2S)-2-amino-6-(oxaloamino)hexanoic acid. InChIKey: VNYBSIRTNZDDTL-YFKPBYRVSA-N.
| Molecular formula | C8H14N2O5 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | (2S)-2-amino-6-(oxaloamino)hexanoic acid |
| InChIKey | VNYBSIRTNZDDTL-YFKPBYRVSA-N |
| SMILES | C(CCNC(=O)C(=O)O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)