cas: 133057-82-6 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-4-Bromo-2-Fluorobenzene, 98%, 98% (CAS 133057-82-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1122L3-100mg |
| cas | 133057-82-6 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 357.20 Pln | |
| Chemat | 10g | 558.80 Pln | |
| Chemat | 25g | 1072.40 Pln | |
| Chemat | 50g | 1835.60 Pln | |
| Chemat | 100g | 3112.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-fluoro-1-phenylmethoxybenzene (CAS 133057-82-6) is a chemical compound with the molecular formula C13H10BrFO and a molecular weight of 281.12 g/mol. IUPAC name: 4-bromo-2-fluoro-1-phenylmethoxybenzene. InChIKey: HCVUDNMNSPYSHS-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO |
|---|---|
| Molecular weight | 281.12 g/mol |
| IUPAC name | 4-bromo-2-fluoro-1-phenylmethoxybenzene |
| InChIKey | HCVUDNMNSPYSHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)