cas: 75462-59-8 — see every product listed under this CAS number, including other names
1-(Chloromethyl)-3,5-bis(trifluoromethyl)benzene 98% (CAS 75462-59-8) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A262318-25g |
| cas | 75462-59-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 203.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A262318 |
1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene (CAS 75462-59-8) is a chemical compound with the molecular formula C9H5ClF6 and a molecular weight of 262.58 g/mol. IUPAC name: 1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene. InChIKey: OINTXXMBRBLMHH-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF6 |
|---|---|
| Molecular weight | 262.58 g/mol |
| IUPAC name | 1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene |
| InChIKey | OINTXXMBRBLMHH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CCl |
Computed by PubChem (NCBI)