cas: 75462-59-8 — see every product listed under this CAS number, including other names
3,5-Bis(trifluoromethyl)benzyl chloride (CAS 75462-59-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006024-1G |
| cas | 75462-59-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 25g | 263.47 Pln | |
| Fluorochem | 100g | 799.74 Pln |
| delivery time | 2-3 weeks |
|---|
1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene (CAS 75462-59-8) is a chemical compound with the molecular formula C9H5ClF6 and a molecular weight of 262.58 g/mol. IUPAC name: 1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene. InChIKey: OINTXXMBRBLMHH-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF6 |
|---|---|
| Molecular weight | 262.58 g/mol |
| IUPAC name | 1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene |
| InChIKey | OINTXXMBRBLMHH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CCl |
Computed by PubChem (NCBI)