cas: 3419-91-8 — see every product listed under this CAS number, including other names
1-(Pyridin-2-Yl)-1H-Indole, 99%, 99% (CAS 3419-91-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CN91-100mg |
| cas | 3419-91-8 |
| size | 100mg |
| availability | 6.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 707.60 Pln | |
| Chemat | 5g | 3232.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
1-pyridin-2-ylindole (CAS 3419-91-8) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 1-pyridin-2-ylindole. InChIKey: VSKZGHVPGOMFAV-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 1-pyridin-2-ylindole |
| InChIKey | VSKZGHVPGOMFAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN2C3=CC=CC=N3 |
Computed by PubChem (NCBI)