cas: 864292-49-9 — see every product listed under this CAS number, including other names
1-(TERT-BUTYL)-4,6-DICHLORO-1H-PYRAZOLO[3,4-D]PYRIMIDINE, 98% (CAS 864292-49-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F304955-100MG |
| cas | 864292-49-9 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 643.54 Pln | |
| Fluorochem | 250mg | 804.94 Pln | |
| Fluorochem | 500mg | 1367.24 Pln | |
| Fluorochem | 1g | 1710.87 Pln | |
| Fluorochem | 5g | 4329.74 Pln | |
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 654.80 Pln | |
| Chemat | 1g | 1245.20 Pln | |
| Chemat | 5g | 3549.20 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1-tert-butyl-4,6-dichloropyrazolo[5,4-d]pyrimidine (CAS 864292-49-9) is a chemical compound with the molecular formula C9H10Cl2N4 and a molecular weight of 245.11 g/mol. IUPAC name: 1-tert-butyl-4,6-dichloropyrazolo[5,4-d]pyrimidine. InChIKey: KQMSQBIJCSGTAY-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N4 |
|---|---|
| Molecular weight | 245.11 g/mol |
| IUPAC name | 1-tert-butyl-4,6-dichloropyrazolo[5,4-d]pyrimidine |
| InChIKey | KQMSQBIJCSGTAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=C(C=N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)