CAS 46409-23-8 is the registry number for N,N-Diallyl-4,6-dichloro-1,3,5-triazin-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4,6-dichloro-N,N-bis(prop-2-enyl)-1,3,5-triazin-2-amine (CAS 46409-23-8) is a chemical compound with the molecular formula C9H10Cl2N4 and a molecular weight of 245.11 g/mol. IUPAC name: 4,6-dichloro-N,N-bis(prop-2-enyl)-1,3,5-triazin-2-amine. InChIKey: HZFDWUMFTMMDKS-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N4 |
|---|---|
| Molecular weight | 245.11 g/mol |
| IUPAC name | 4,6-dichloro-N,N-bis(prop-2-enyl)-1,3,5-triazin-2-amine |
| InChIKey | HZFDWUMFTMMDKS-UHFFFAOYSA-N |
| SMILES | C=CCN(CC=C)C1=NC(=NC(=N1)Cl)Cl |
Computed by PubChem (NCBI)