CAS 140199-55-9 is the registry number for 2-Butyl-4,7-dichloro-1H-imidazo[4,5-d]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-butyl-4,7-dichloro-1H-imidazo[4,5-d]pyridazine (CAS 140199-55-9) is a chemical compound with the molecular formula C9H10Cl2N4 and a molecular weight of 245.11 g/mol. IUPAC name: 2-butyl-4,7-dichloro-1H-imidazo[4,5-d]pyridazine. InChIKey: JSBFFOHNZBZACQ-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N4 |
|---|---|
| Molecular weight | 245.11 g/mol |
| IUPAC name | 2-butyl-4,7-dichloro-1H-imidazo[4,5-d]pyridazine |
| InChIKey | JSBFFOHNZBZACQ-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2=C(N1)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)