CAS 864292-49-9 appears in our catalog under these names: 1-(tert-Butyl)-4,6-dichloro-1H-pyrazolo(3,4-d)pyrimidine, 98%, 1-tert-Butyl-4,6-dichloro-1H-pyrazolo(3,4-d)pyrimidine, 1-(tert-Butyl)-4,6-dichloro-1H-pyrazolo[3,4-d]pyrimidine, 98%, 98%, 1-(TERT-BUTYL)-4,6-DICHLORO-1H-PYRAZOLO[3,4-D]PYRIMIDINE, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g, 500mg.
1-tert-butyl-4,6-dichloropyrazolo[5,4-d]pyrimidine (CAS 864292-49-9) is a chemical compound with the molecular formula C9H10Cl2N4 and a molecular weight of 245.11 g/mol. IUPAC name: 1-tert-butyl-4,6-dichloropyrazolo[5,4-d]pyrimidine. InChIKey: KQMSQBIJCSGTAY-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N4 |
|---|---|
| Molecular weight | 245.11 g/mol |
| IUPAC name | 1-tert-butyl-4,6-dichloropyrazolo[5,4-d]pyrimidine |
| InChIKey | KQMSQBIJCSGTAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=C(C=N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)