Products 86696-87-9
CAS 86696-87-9 is the registry number for Aganodine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4,7-dichloro-1,3-dihydroisoindol-2-yl)guanidine (CAS 86696-87-9) is a chemical compound with the molecular formula C9H10Cl2N4 and a molecular weight of 245.11 g/mol. IUPAC name: 2-(4,7-dichloro-1,3-dihydroisoindol-2-yl)guanidine. InChIKey: DFKHOVYSCCPSHR-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N4 |
|---|---|
| Molecular weight | 245.11 g/mol |
| IUPAC name | 2-(4,7-dichloro-1,3-dihydroisoindol-2-yl)guanidine |
| InChIKey | DFKHOVYSCCPSHR-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2CN1N=C(N)N)Cl)Cl |
Computed by PubChem (NCBI)