CAS 1221725-59-2 is the registry number for (1-(2-Chlorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[1-(2-chlorophenyl)triazol-4-yl]methanamine;hydrochloride (CAS 1221725-59-2) is a chemical compound with the molecular formula C9H10Cl2N4 and a molecular weight of 245.11 g/mol. IUPAC name: [1-(2-chlorophenyl)triazol-4-yl]methanamine;hydrochloride. InChIKey: XHYAJDUBPXSFNJ-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N4 |
|---|---|
| Molecular weight | 245.11 g/mol |
| IUPAC name | [1-(2-chlorophenyl)triazol-4-yl]methanamine;hydrochloride |
| InChIKey | XHYAJDUBPXSFNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=C(N=N2)CN)Cl.Cl |
Computed by PubChem (NCBI)