CAS 1313026-86-6 appears in our catalog under these names: 2,6-Dichloro-9-isopropyl-8-methyl-9h-purine, 97%, 2,6-Dichloro-9-isopropyl-8-methyl-9H-purine, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 100g.
2,6-dichloro-8-methyl-9-propan-2-ylpurine (CAS 1313026-86-6) is a chemical compound with the molecular formula C9H10Cl2N4 and a molecular weight of 245.11 g/mol. IUPAC name: 2,6-dichloro-8-methyl-9-propan-2-ylpurine. InChIKey: CAZPSBRBADZWAY-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N4 |
|---|---|
| Molecular weight | 245.11 g/mol |
| IUPAC name | 2,6-dichloro-8-methyl-9-propan-2-ylpurine |
| InChIKey | CAZPSBRBADZWAY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C(C)C)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)