cas: 876317-19-0 — see every product listed under this CAS number, including other names
1-(tert-Butoxycarbonyl)-4-oxopyrrolidine-2-carboxylic acid, 97% (CAS 876317-19-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092922-250MG |
| cas | 876317-19-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 357.18 Pln | |
| Fluorochem | 10g | 659.16 Pln | |
| Fluorochem | 25g | 1549.47 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopyrrolidine-2-carboxylic acid (CAS 876317-19-0) is a chemical compound with the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopyrrolidine-2-carboxylic acid. InChIKey: CKYGSXRXTIKGAJ-UHFFFAOYSA-N.
| Molecular formula | C10H15NO5 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopyrrolidine-2-carboxylic acid |
| InChIKey | CKYGSXRXTIKGAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC1C(=O)O |
Computed by PubChem (NCBI)