cas: 876317-19-0 — see every product listed under this CAS number, including other names
1-(tert-Butoxycarbonyl)-4-oxopyrrolidine-2-carboxylicacid, 97%, 97% (CAS 876317-19-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147DA-100mg |
| cas | 876317-19-0 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 10g | 424.40 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 100g | 2978.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopyrrolidine-2-carboxylic acid (CAS 876317-19-0) is a chemical compound with the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopyrrolidine-2-carboxylic acid. InChIKey: CKYGSXRXTIKGAJ-UHFFFAOYSA-N.
| Molecular formula | C10H15NO5 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopyrrolidine-2-carboxylic acid |
| InChIKey | CKYGSXRXTIKGAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC1C(=O)O |
Computed by PubChem (NCBI)